C18H19Cl2N5O5 — CID 172874680
2-[1-(3,4-dichlorophenyl)-1-hydroxyethyl]-5-[6-(methoxyamino)purin-9-yl]oxolane-3,4-diol (PubChem CID 172874680) has the molecular formula C18H19Cl2N5O5 and a molecular weight of 456.29 g/mol. Its IUPAC name is 2-[1-(3,4-dichlorophenyl)-1-hydroxyethyl]-5-[6-(methoxyamino)purin-9-yl]oxolane-3,4-diol.
| Compound Name | 2-[1-(3,4-dichlorophenyl)-1-hydroxyethyl]-5-[6-(methoxyamino)purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 172874680 |
| Molecular Formula | C18H19Cl2N5O5 |
| Molecular Weight | 456.29 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | 2-[1-(3,4-dichlorophenyl)-1-hydroxyethyl]-5-[6-(methoxyamino)purin-9-yl]oxolane-3,4-diol |
| SMILES | CONc1ncnc2c1ncn2C1OC(C(C)(O)c2ccc(Cl)c(Cl)c2)C(O)C1O |
| InChI | InChI=1S/C18H19Cl2N5O5/c1-18(28,8-3-4-9(19)10(20)5-8)14-12(26)13(27)17(30-14)25-7-23-11-15(24-29-2)21-6-22-16(11)25/h3-7,12-14,17,26-28H,1-2H3,(H,21,22,24) |
| InChIKey | MTJCHKWJANVQIN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 134.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.29 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|