C20H22Cl2N4O5 — CID 135307510
(2S,3S,4R,5R)-2-[(1R)-1-(3,4-dichlorophenyl)-1-hydroxyethyl]-5-[4-(ethoxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolane-3,4-diol (PubChem CID 135307510) has the molecular formula C20H22Cl2N4O5 and a molecular weight of 469.33 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-[(1R)-1-(3,4-dichlorophenyl)-1-hydroxyethyl]-5-[4-(ethoxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolane-3,4-diol.
| Compound Name | (2S,3S,4R,5R)-2-[(1R)-1-(3,4-dichlorophenyl)-1-hydroxyethyl]-5-[4-(ethoxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 135307510 |
| Molecular Formula | C20H22Cl2N4O5 |
| Molecular Weight | 469.33 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | (2S,3S,4R,5R)-2-[(1R)-1-(3,4-dichlorophenyl)-1-hydroxyethyl]-5-[4-(ethoxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolane-3,4-diol |
| SMILES | CCONc1ncnc2c1ccn2[C@@H]1O[C@H]([C@](C)(O)c2ccc(Cl)c(Cl)c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H22Cl2N4O5/c1-3-30-25-17-11-6-7-26(18(11)24-9-23-17)19-15(28)14(27)16(31-19)20(2,29)10-4-5-12(21)13(22)8-10/h4-9,14-16,19,27-29H,3H2,1-2H3,(H,23,24,25)/t14-,15+,16-,19+,20+/m0/s1 |
| InChIKey | QSWFOYVXGNRPRC-HRYJEPKJSA-N |
| XLogP | 2.63 |
| TPSA | 121.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|