C18H20ClN5O3 — CID 155175346
(2R,3S,4R,5R)-2-[(4-chlorophenyl)methyl]-5-[4-(2-methylhydrazinyl)pyrrolo[2,3-d]pyrimidin-7-yl]oxolane-3,4-diol (PubChem CID 155175346) has the molecular formula C18H20ClN5O3 and a molecular weight of 389.84 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-[(4-chlorophenyl)methyl]-5-[4-(2-methylhydrazinyl)pyrrolo[2,3-d]pyrimidin-7-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-[(4-chlorophenyl)methyl]-5-[4-(2-methylhydrazinyl)pyrrolo[2,3-d]pyrimidin-7-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 155175346 |
| Molecular Formula | C18H20ClN5O3 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | (2R,3S,4R,5R)-2-[(4-chlorophenyl)methyl]-5-[4-(2-methylhydrazinyl)pyrrolo[2,3-d]pyrimidin-7-yl]oxolane-3,4-diol |
| SMILES | CNNc1ncnc2c1ccn2[C@@H]1O[C@H](Cc2ccc(Cl)cc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H20ClN5O3/c1-20-23-16-12-6-7-24(17(12)22-9-21-16)18-15(26)14(25)13(27-18)8-10-2-4-11(19)5-3-10/h2-7,9,13-15,18,20,25-26H,8H2,1H3,(H,21,22,23)/t13-,14-,15-,18-/m1/s1 |
| InChIKey | FJQCZZASQWVHSN-ATNYBXOESA-N |
| XLogP | 1.49 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|