C21H23Cl2N3O5 — CID 135316673
(2S,3S,4R,5R)-2-[1-(3,4-dichlorophenyl)-1-hydroxyethyl]-5-[4-(2-methoxyethyl)pyrrolo[2,3-d]pyrimidin-7-yl]oxolane-3,4-diol (PubChem CID 135316673) has the molecular formula C21H23Cl2N3O5 and a molecular weight of 468.34 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-[1-(3,4-dichlorophenyl)-1-hydroxyethyl]-5-[4-(2-methoxyethyl)pyrrolo[2,3-d]pyrimidin-7-yl]oxolane-3,4-diol.
| Compound Name | (2S,3S,4R,5R)-2-[1-(3,4-dichlorophenyl)-1-hydroxyethyl]-5-[4-(2-methoxyethyl)pyrrolo[2,3-d]pyrimidin-7-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 135316673 |
| Molecular Formula | C21H23Cl2N3O5 |
| Molecular Weight | 468.34 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | (2S,3S,4R,5R)-2-[1-(3,4-dichlorophenyl)-1-hydroxyethyl]-5-[4-(2-methoxyethyl)pyrrolo[2,3-d]pyrimidin-7-yl]oxolane-3,4-diol |
| SMILES | COCCc1ncnc2c1ccn2[C@@H]1O[C@H](C(C)(O)c2ccc(Cl)c(Cl)c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H23Cl2N3O5/c1-21(29,11-3-4-13(22)14(23)9-11)18-16(27)17(28)20(31-18)26-7-5-12-15(6-8-30-2)24-10-25-19(12)26/h3-5,7,9-10,16-18,20,27-29H,6,8H2,1-2H3/t16-,17+,18-,20+,21?/m0/s1 |
| InChIKey | LNBFCMDSDADGQH-MYTGEXCLSA-N |
| XLogP | 2.45 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |