C20H21Cl2N5O4 — CID 155169688
1-[(3aR,4R,6S,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1-(3,4-dichlorophenyl)ethanol (PubChem CID 155169688) has the molecular formula C20H21Cl2N5O4 and a molecular weight of 466.33 g/mol. Its IUPAC name is 1-[(3aR,4R,6S,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1-(3,4-dichlorophenyl)ethanol.
| Compound Name | 1-[(3aR,4R,6S,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1-(3,4-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 155169688 |
| Molecular Formula | C20H21Cl2N5O4 |
| Molecular Weight | 466.33 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 1-[(3aR,4R,6S,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1-(3,4-dichlorophenyl)ethanol |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](C(C)(O)c1ccc(Cl)c(Cl)c1)O[C@H]2n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C20H21Cl2N5O4/c1-19(2)30-13-14(31-19)18(27-8-26-12-16(23)24-7-25-17(12)27)29-15(13)20(3,28)9-4-5-10(21)11(22)6-9/h4-8,13-15,18,28H,1-3H3,(H2,23,24,25)/t13-,14+,15-,18+,20?/m0/s1 |
| InChIKey | UUCOJTLYIDQUDA-GVSIQAFYSA-N |
| XLogP | 3.04 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |