C12H14ClN5O4 — CID 23361908
2-[2-chloro-6-(methoxyamino)purin-9-yl]-5-ethenyloxolane-3,4-diol (PubChem CID 23361908) has the molecular formula C12H14ClN5O4 and a molecular weight of 327.73 g/mol. Its IUPAC name is 2-[2-chloro-6-(methoxyamino)purin-9-yl]-5-ethenyloxolane-3,4-diol.
| Compound Name | 2-[2-chloro-6-(methoxyamino)purin-9-yl]-5-ethenyloxolane-3,4-diol |
|---|---|
| PubChem CID | 23361908 |
| Molecular Formula | C12H14ClN5O4 |
| Molecular Weight | 327.73 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 2-[2-chloro-6-(methoxyamino)purin-9-yl]-5-ethenyloxolane-3,4-diol |
| SMILES | C=CC1OC(n2cnc3c(NOC)nc(Cl)nc32)C(O)C1O |
| InChI | InChI=1S/C12H14ClN5O4/c1-3-5-7(19)8(20)11(22-5)18-4-14-6-9(17-21-2)15-12(13)16-10(6)18/h3-5,7-8,11,19-20H,1H2,2H3,(H,15,16,17) |
| InChIKey | NXIRSLRYLSFOHD-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.73 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|