C26H22ClN5O6 — CID 22868440
[(2R,3R,4R,5R)-4-benzoyloxy-5-[2-chloro-6-(methoxyamino)purin-9-yl]-2-ethenyloxolan-3-yl] benzoate (PubChem CID 22868440) has the molecular formula C26H22ClN5O6 and a molecular weight of 535.94 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-4-benzoyloxy-5-[2-chloro-6-(methoxyamino)purin-9-yl]-2-ethenyloxolan-3-yl] benzoate.
| Compound Name | [(2R,3R,4R,5R)-4-benzoyloxy-5-[2-chloro-6-(methoxyamino)purin-9-yl]-2-ethenyloxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 22868440 |
| Molecular Formula | C26H22ClN5O6 |
| Molecular Weight | 535.94 g/mol |
| Exact Mass | 535.13 |
| IUPAC Name | [(2R,3R,4R,5R)-4-benzoyloxy-5-[2-chloro-6-(methoxyamino)purin-9-yl]-2-ethenyloxolan-3-yl] benzoate |
| SMILES | C=C[C@H]1O[C@@H](n2cnc3c(NOC)nc(Cl)nc32)[C@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H22ClN5O6/c1-3-17-19(37-24(33)15-10-6-4-7-11-15)20(38-25(34)16-12-8-5-9-13-16)23(36-17)32-14-28-18-21(31-35-2)29-26(27)30-22(18)32/h3-14,17,19-20,23H,1H2,2H3,(H,29,30,31)/t17-,19-,20-,23-/m1/s1 |
| InChIKey | PFDRMQRZGKIRFG-ZDXOVATRSA-N |
| XLogP | 3.99 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.94 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|