C22H25ClN6O3S — CID 57191238
(2R,5R)-2-[2-chloro-6-[(4-phenylsulfanylpiperidin-1-yl)amino]purin-9-yl]-5-ethenyloxolane-3,4-diol (PubChem CID 57191238) has the molecular formula C22H25ClN6O3S and a molecular weight of 489.00 g/mol. Its IUPAC name is (2R,5R)-2-[2-chloro-6-[(4-phenylsulfanylpiperidin-1-yl)amino]purin-9-yl]-5-ethenyloxolane-3,4-diol.
| Compound Name | (2R,5R)-2-[2-chloro-6-[(4-phenylsulfanylpiperidin-1-yl)amino]purin-9-yl]-5-ethenyloxolane-3,4-diol |
|---|---|
| PubChem CID | 57191238 |
| Molecular Formula | C22H25ClN6O3S |
| Molecular Weight | 489.00 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | (2R,5R)-2-[2-chloro-6-[(4-phenylsulfanylpiperidin-1-yl)amino]purin-9-yl]-5-ethenyloxolane-3,4-diol |
| SMILES | C=C[C@H]1O[C@@H](n2cnc3c(NN4CCC(Sc5ccccc5)CC4)nc(Cl)nc32)C(O)C1O |
| InChI | InChI=1S/C22H25ClN6O3S/c1-2-15-17(30)18(31)21(32-15)29-12-24-16-19(25-22(23)26-20(16)29)27-28-10-8-14(9-11-28)33-13-6-4-3-5-7-13/h2-7,12,14-15,17-18,21,30-31H,1,8-11H2,(H,25,26,27)/t15-,17?,18?,21-/m1/s1 |
| InChIKey | SMHGYUWMOCYWKB-BDROVNNXSA-N |
| XLogP | 2.87 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.00 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|