C16H22Cl2N6O4 — CID 86750100
(2S,3R,4S,5S)-2-[2-chloro-6-[(2-ethoxypyrrolidin-1-yl)amino]purin-9-yl]-5-(chloromethyl)oxolane-3,4-diol (PubChem CID 86750100) has the molecular formula C16H22Cl2N6O4 and a molecular weight of 433.30 g/mol. Its IUPAC name is (2S,3R,4S,5S)-2-[2-chloro-6-[(2-ethoxypyrrolidin-1-yl)amino]purin-9-yl]-5-(chloromethyl)oxolane-3,4-diol.
| Compound Name | (2S,3R,4S,5S)-2-[2-chloro-6-[(2-ethoxypyrrolidin-1-yl)amino]purin-9-yl]-5-(chloromethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 86750100 |
| Molecular Formula | C16H22Cl2N6O4 |
| Molecular Weight | 433.30 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | (2S,3R,4S,5S)-2-[2-chloro-6-[(2-ethoxypyrrolidin-1-yl)amino]purin-9-yl]-5-(chloromethyl)oxolane-3,4-diol |
| SMILES | CCOC1CCCN1Nc1nc(Cl)nc2c1ncn2[C@H]1O[C@H](CCl)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H22Cl2N6O4/c1-2-27-9-4-3-5-24(9)22-13-10-14(21-16(18)20-13)23(7-19-10)15-12(26)11(25)8(6-17)28-15/h7-9,11-12,15,25-26H,2-6H2,1H3,(H,20,21,22)/t8-,9?,11-,12-,15+/m1/s1 |
| InChIKey | YBCSNCCRJXUBIF-ZJSOHHELSA-N |
| XLogP | 1.12 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.30 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|