C25H28ClN5O7 — CID 89335815
[(1R,2S,8R)-8-(2-amino-6-chloropurin-9-yl)-4,4,13,13-tetramethyl-3,5,9,12,14-pentaoxatricyclo[8.4.0.02,6]tetradecan-7-yl] benzoate (PubChem CID 89335815) has the molecular formula C25H28ClN5O7 and a molecular weight of 545.98 g/mol. Its IUPAC name is [(1R,2S,8R)-8-(2-amino-6-chloropurin-9-yl)-4,4,13,13-tetramethyl-3,5,9,12,14-pentaoxatricyclo[8.4.0.02,6]tetradecan-7-yl] benzoate.
| Compound Name | [(1R,2S,8R)-8-(2-amino-6-chloropurin-9-yl)-4,4,13,13-tetramethyl-3,5,9,12,14-pentaoxatricyclo[8.4.0.02,6]tetradecan-7-yl] benzoate |
|---|---|
| PubChem CID | 89335815 |
| Molecular Formula | C25H28ClN5O7 |
| Molecular Weight | 545.98 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | [(1R,2S,8R)-8-(2-amino-6-chloropurin-9-yl)-4,4,13,13-tetramethyl-3,5,9,12,14-pentaoxatricyclo[8.4.0.02,6]tetradecan-7-yl] benzoate |
| SMILES | CC1(C)OCC2O[C@@H](n3cnc4c(Cl)nc(N)nc43)C(OC(=O)c3ccccc3)C3OC(C)(C)O[C@H]3[C@@H]2O1 |
| InChI | InChI=1S/C25H28ClN5O7/c1-24(2)33-10-13-15(36-24)16-17(38-25(3,4)37-16)18(35-22(32)12-8-6-5-7-9-12)21(34-13)31-11-28-14-19(26)29-23(27)30-20(14)31/h5-9,11,13,15-18,21H,10H2,1-4H3,(H2,27,29,30)/t13?,15-,16+,17?,18?,21-/m1/s1 |
| InChIKey | USCWUWXEOHSTDP-DKYAJAIZSA-N |
| XLogP | 2.86 |
| TPSA | 142.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.98 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |