C19H25ClN4O6 — CID 89338614
(1R,6R,8R)-8-(2-amino-4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-4,4,13,13-tetramethyl-3,5,9,12,14-pentaoxatricyclo[8.4.0.02,6]tetradecan-7-ol (PubChem CID 89338614) has the molecular formula C19H25ClN4O6 and a molecular weight of 440.88 g/mol. Its IUPAC name is (1R,6R,8R)-8-(2-amino-4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-4,4,13,13-tetramethyl-3,5,9,12,14-pentaoxatricyclo[8.4.0.02,6]tetradecan-7-ol.
| Compound Name | (1R,6R,8R)-8-(2-amino-4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-4,4,13,13-tetramethyl-3,5,9,12,14-pentaoxatricyclo[8.4.0.02,6]tetradecan-7-ol |
|---|---|
| PubChem CID | 89338614 |
| Molecular Formula | C19H25ClN4O6 |
| Molecular Weight | 440.88 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | (1R,6R,8R)-8-(2-amino-4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-4,4,13,13-tetramethyl-3,5,9,12,14-pentaoxatricyclo[8.4.0.02,6]tetradecan-7-ol |
| SMILES | CC1(C)OCC2O[C@@H](n3ccc4c(Cl)nc(N)nc43)C(O)[C@H]3OC(C)(C)OC3[C@@H]2O1 |
| InChI | InChI=1S/C19H25ClN4O6/c1-18(2)26-7-9-11(28-18)13-12(29-19(3,4)30-13)10(25)16(27-9)24-6-5-8-14(20)22-17(21)23-15(8)24/h5-6,9-13,16,25H,7H2,1-4H3,(H2,21,22,23)/t9?,10?,11-,12-,13?,16-/m1/s1 |
| InChIKey | XXFJDUIJWFGGJL-DUBOXLJPSA-N |
| XLogP | 1.60 |
| TPSA | 123.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.88 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |