C36H32N6O3 — CID 68918831
2-[(3-aminophenyl)-diphenylmethoxy]-2-[(2S,5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]-1-phenylethanone (PubChem CID 68918831) has the molecular formula C36H32N6O3 and a molecular weight of 596.69 g/mol. Its IUPAC name is 2-[(3-aminophenyl)-diphenylmethoxy]-2-[(2S,5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]-1-phenylethanone.
| Compound Name | 2-[(3-aminophenyl)-diphenylmethoxy]-2-[(2S,5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 68918831 |
| Molecular Formula | C36H32N6O3 |
| Molecular Weight | 596.69 g/mol |
| Exact Mass | 596.25 |
| IUPAC Name | 2-[(3-aminophenyl)-diphenylmethoxy]-2-[(2S,5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]-1-phenylethanone |
| SMILES | Nc1cccc(C(OC(C(=O)c2ccccc2)[C@@H]2CC[C@H](n3cnc4c(N)ncnc43)O2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C36H32N6O3/c37-28-18-10-17-27(21-28)36(25-13-6-2-7-14-25,26-15-8-3-9-16-26)45-33(32(43)24-11-4-1-5-12-24)29-19-20-30(44-29)42-23-41-31-34(38)39-22-40-35(31)42/h1-18,21-23,29-30,33H,19-20,37H2,(H2,38,39,40)/t29-,30+,33?/m0/s1 |
| InChIKey | PLYYHIGYHLRTLP-DPRQTADFSA-N |
| XLogP | 5.93 |
| TPSA | 131.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.69 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|