C17H17N5O6P+ — CID 18634573
[1-[(2S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]-2-oxo-2-phenylethoxy]-hydroxy-oxophosphanium (PubChem CID 18634573) has the molecular formula C17H17N5O6P+ and a molecular weight of 418.33 g/mol. Its IUPAC name is [1-[(2S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]-2-oxo-2-phenylethoxy]-hydroxy-oxophosphanium.
| Compound Name | [1-[(2S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]-2-oxo-2-phenylethoxy]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 18634573 |
| Molecular Formula | C17H17N5O6P+ |
| Molecular Weight | 418.33 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | [1-[(2S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]-2-oxo-2-phenylethoxy]-hydroxy-oxophosphanium |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](C(O[P+](=O)O)C(=O)c2ccccc2)C[C@H]1O |
| InChI | InChI=1S/C17H16N5O6P/c18-15-12-16(20-7-19-15)22(8-21-12)17-10(23)6-11(27-17)14(28-29(25)26)13(24)9-4-2-1-3-5-9/h1-5,7-8,10-11,14,17,23H,6H2,(H2-,18,19,20,25,26)/p+1/t10-,11+,14?,17-/m1/s1 |
| InChIKey | SYUUSKHETNSOSN-YOBFUAPNSA-O |
| XLogP | 0.97 |
| TPSA | 162.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.33 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|