C33H33N3O6 — CID 14375718
(2R,4S,5R,6S)-4-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-5-morpholin-4-yl-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-10-one (PubChem CID 14375718) has the molecular formula C33H33N3O6 and a molecular weight of 567.64 g/mol. Its IUPAC name is (2R,4S,5R,6S)-4-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-5-morpholin-4-yl-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-10-one.
| Compound Name | (2R,4S,5R,6S)-4-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-5-morpholin-4-yl-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-10-one |
|---|---|
| PubChem CID | 14375718 |
| Molecular Formula | C33H33N3O6 |
| Molecular Weight | 567.64 g/mol |
| Exact Mass | 567.24 |
| IUPAC Name | (2R,4S,5R,6S)-4-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-5-morpholin-4-yl-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-10-one |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H]3[C@@H](Oc4nc(=O)ccn43)[C@@H]2N2CCOCC2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H33N3O6/c1-38-26-14-12-25(13-15-26)33(23-8-4-2-5-9-23,24-10-6-3-7-11-24)40-22-27-29(35-18-20-39-21-19-35)30-31(41-27)36-17-16-28(37)34-32(36)42-30/h2-17,27,29-31H,18-22H2,1H3/t27-,29-,30+,31-/m1/s1 |
| InChIKey | JKDWANNFZVYAHI-WPFAILKGSA-N |
| XLogP | 3.62 |
| TPSA | 84.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.64 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|