C28H24N2O5 — CID 618321
5-hydroxy-4-(trityloxymethyl)-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-10-one (PubChem CID 618321) has the molecular formula C28H24N2O5 and a molecular weight of 468.51 g/mol. Its IUPAC name is 5-hydroxy-4-(trityloxymethyl)-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-10-one.
| Compound Name | 5-hydroxy-4-(trityloxymethyl)-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-10-one |
|---|---|
| PubChem CID | 618321 |
| Molecular Formula | C28H24N2O5 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 5-hydroxy-4-(trityloxymethyl)-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-10-one |
| SMILES | O=c1ccn2c(n1)OC1C(O)C(COC(c3ccccc3)(c3ccccc3)c3ccccc3)OC12 |
| InChI | InChI=1S/C28H24N2O5/c31-23-16-17-30-26-25(35-27(30)29-23)24(32)22(34-26)18-33-28(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-17,22,24-26,32H,18H2 |
| InChIKey | NFHHXCWJWPCPQE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|