C9H13N2O14P3 — CID 146173813
[hydroxy-[[(2R,5S,6R)-5-hydroxy-10-oxo-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-4-yl]methoxy]phosphoryl] phosphono hydrogen phosphate (PubChem CID 146173813) has the molecular formula C9H13N2O14P3 and a molecular weight of 466.13 g/mol. Its IUPAC name is [hydroxy-[[(2R,5S,6R)-5-hydroxy-10-oxo-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-4-yl]methoxy]phosphoryl] phosphono hydrogen phosphate.
| Compound Name | [hydroxy-[[(2R,5S,6R)-5-hydroxy-10-oxo-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-4-yl]methoxy]phosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 146173813 |
| Molecular Formula | C9H13N2O14P3 |
| Molecular Weight | 466.13 g/mol |
| Exact Mass | 465.96 |
| IUPAC Name | [hydroxy-[[(2R,5S,6R)-5-hydroxy-10-oxo-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-4-yl]methoxy]phosphoryl] phosphono hydrogen phosphate |
| SMILES | O=c1ccn2c(n1)O[C@H]1[C@H]2OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H]1O |
| InChI | InChI=1S/C9H13N2O14P3/c12-5-1-2-11-8-7(23-9(11)10-5)6(13)4(22-8)3-21-27(17,18)25-28(19,20)24-26(14,15)16/h1-2,4,6-8,13H,3H2,(H,17,18)(H,19,20)(H2,14,15,16)/t4?,6-,7+,8+/m0/s1 |
| InChIKey | BCVDHAYEJIHXLG-AUXBNOSTSA-N |
| XLogP | -1.39 |
| TPSA | 233.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.13 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|