C14H17ClNO14P3 — CID 10232455
[[(2S,3S,4R,5S)-5-(7-chloro-1-oxoisoquinolin-2-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 10232455) has the molecular formula C14H17ClNO14P3 and a molecular weight of 551.66 g/mol. Its IUPAC name is [[(2S,3S,4R,5S)-5-(7-chloro-1-oxoisoquinolin-2-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2S,3S,4R,5S)-5-(7-chloro-1-oxoisoquinolin-2-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 10232455 |
| Molecular Formula | C14H17ClNO14P3 |
| Molecular Weight | 551.66 g/mol |
| Exact Mass | 550.96 |
| IUPAC Name | [[(2S,3S,4R,5S)-5-(7-chloro-1-oxoisoquinolin-2-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | O=c1c2cc(Cl)ccc2ccn1[C@H]1O[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H17ClNO14P3/c15-8-2-1-7-3-4-16(13(19)9(7)5-8)14-12(18)11(17)10(28-14)6-27-32(23,24)30-33(25,26)29-31(20,21)22/h1-5,10-12,14,17-18H,6H2,(H,23,24)(H,25,26)(H2,20,21,22)/t10-,11+,12+,14-/m0/s1 |
| InChIKey | OIBMBKVCJFCFMA-SFTQSGBHSA-N |
| XLogP | 0.62 |
| TPSA | 231.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.66 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|