C16H21N2O15P3 — CID 148945727
[[(2R,3R,4S,5R)-5-(3-benzyl-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 148945727) has the molecular formula C16H21N2O15P3 and a molecular weight of 574.27 g/mol. Its IUPAC name is [[(2R,3R,4S,5R)-5-(3-benzyl-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,4S,5R)-5-(3-benzyl-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 148945727 |
| Molecular Formula | C16H21N2O15P3 |
| Molecular Weight | 574.27 g/mol |
| Exact Mass | 574.02 |
| IUPAC Name | [[(2R,3R,4S,5R)-5-(3-benzyl-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | O=c1ccn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@H](O)[C@@H]2O)c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C16H21N2O15P3/c19-12-6-7-17(16(22)18(12)8-10-4-2-1-3-5-10)15-14(21)13(20)11(31-15)9-30-35(26,27)33-36(28,29)32-34(23,24)25/h1-7,11,13-15,20-21H,8-9H2,(H,26,27)(H,28,29)(H2,23,24,25)/t11-,13+,14+,15-/m1/s1 |
| InChIKey | POWVPSNWOKZLNV-UQOMUDLDSA-N |
| XLogP | -0.98 |
| TPSA | 253.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.27 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|