C17H22FN2O15P3 — CID 140855143
[[(2R,3R,5R)-5-[3-[2-(4-fluorophenyl)ethyl]-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 140855143) has the molecular formula C17H22FN2O15P3 and a molecular weight of 606.28 g/mol. Its IUPAC name is [[(2R,3R,5R)-5-[3-[2-(4-fluorophenyl)ethyl]-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,5R)-5-[3-[2-(4-fluorophenyl)ethyl]-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 140855143 |
| Molecular Formula | C17H22FN2O15P3 |
| Molecular Weight | 606.28 g/mol |
| Exact Mass | 606.02 |
| IUPAC Name | [[(2R,3R,5R)-5-[3-[2-(4-fluorophenyl)ethyl]-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | O=c1ccn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@H](O)C2O)c(=O)n1CCc1ccc(F)cc1 |
| InChI | InChI=1S/C17H22FN2O15P3/c18-11-3-1-10(2-4-11)5-7-19-13(21)6-8-20(17(19)24)16-15(23)14(22)12(33-16)9-32-37(28,29)35-38(30,31)34-36(25,26)27/h1-4,6,8,12,14-16,22-23H,5,7,9H2,(H,28,29)(H,30,31)(H2,25,26,27)/t12-,14+,15?,16-/m1/s1 |
| InChIKey | KZKSLHIBDJTEFH-DJFRYGSHSA-N |
| XLogP | -0.65 |
| TPSA | 253.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.28 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|