C17H20FN2O9P — CID 140855177
[(2R,3R,5R)-5-[3-[2-(2-fluorophenyl)ethyl]-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 140855177) has the molecular formula C17H20FN2O9P and a molecular weight of 446.32 g/mol. Its IUPAC name is [(2R,3R,5R)-5-[3-[2-(2-fluorophenyl)ethyl]-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3R,5R)-5-[3-[2-(2-fluorophenyl)ethyl]-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 140855177 |
| Molecular Formula | C17H20FN2O9P |
| Molecular Weight | 446.32 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | [(2R,3R,5R)-5-[3-[2-(2-fluorophenyl)ethyl]-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=c1ccn([C@@H]2O[C@H](COP(=O)(O)O)[C@H](O)C2O)c(=O)n1CCc1ccccc1F |
| InChI | InChI=1S/C17H20FN2O9P/c18-11-4-2-1-3-10(11)5-7-19-13(21)6-8-20(17(19)24)16-15(23)14(22)12(29-16)9-28-30(25,26)27/h1-4,6,8,12,14-16,22-23H,5,7,9H2,(H2,25,26,27)/t12-,14+,15?,16-/m1/s1 |
| InChIKey | DRIOIFKLLTUYOD-DJFRYGSHSA-N |
| XLogP | -0.88 |
| TPSA | 160.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.32 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|