C17H19ClN2O6 — CID 149438020
3-[2-(2-chlorophenyl)ethyl]-1-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 149438020) has the molecular formula C17H19ClN2O6 and a molecular weight of 382.80 g/mol. Its IUPAC name is 3-[2-(2-chlorophenyl)ethyl]-1-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 3-[2-(2-chlorophenyl)ethyl]-1-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 149438020 |
| Molecular Formula | C17H19ClN2O6 |
| Molecular Weight | 382.80 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 3-[2-(2-chlorophenyl)ethyl]-1-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn([C@@H]2O[C@H](CO)[C@H](O)[C@@H]2O)c(=O)n1CCc1ccccc1Cl |
| InChI | InChI=1S/C17H19ClN2O6/c18-11-4-2-1-3-10(11)5-7-19-13(22)6-8-20(17(19)25)16-15(24)14(23)12(9-21)26-16/h1-4,6,8,12,14-16,21,23-24H,5,7,9H2/t12-,14+,15+,16-/m1/s1 |
| InChIKey | YVEQQAUCBSNBEP-SYAUCNOPSA-N |
| XLogP | -0.48 |
| TPSA | 113.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.80 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |