C18H23N2O9P — CID 140855146
[(2R,3R,5R)-3,4-dihydroxy-5-[3-[2-(2-methylphenyl)ethyl]-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 140855146) has the molecular formula C18H23N2O9P and a molecular weight of 442.36 g/mol. Its IUPAC name is [(2R,3R,5R)-3,4-dihydroxy-5-[3-[2-(2-methylphenyl)ethyl]-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3R,5R)-3,4-dihydroxy-5-[3-[2-(2-methylphenyl)ethyl]-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 140855146 |
| Molecular Formula | C18H23N2O9P |
| Molecular Weight | 442.36 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | [(2R,3R,5R)-3,4-dihydroxy-5-[3-[2-(2-methylphenyl)ethyl]-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | Cc1ccccc1CCn1c(=O)ccn([C@@H]2O[C@H](COP(=O)(O)O)[C@H](O)C2O)c1=O |
| InChI | InChI=1S/C18H23N2O9P/c1-11-4-2-3-5-12(11)6-8-19-14(21)7-9-20(18(19)24)17-16(23)15(22)13(29-17)10-28-30(25,26)27/h2-5,7,9,13,15-17,22-23H,6,8,10H2,1H3,(H2,25,26,27)/t13-,15+,16?,17-/m1/s1 |
| InChIKey | BGUIQGHSHUWAPE-NMBWSBHNSA-N |
| XLogP | -0.71 |
| TPSA | 160.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.36 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|