C18H20F4N2O11P2 — CID 71549894
[[[(2R,3S,4R,5R)-5-[3-(2,2-difluoro-2-phenylethyl)-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]-difluoromethyl]phosphonic acid (PubChem CID 71549894) has the molecular formula C18H20F4N2O11P2 and a molecular weight of 578.30 g/mol. Its IUPAC name is [[[(2R,3S,4R,5R)-5-[3-(2,2-difluoro-2-phenylethyl)-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]-difluoromethyl]phosphonic acid.
| Compound Name | [[[(2R,3S,4R,5R)-5-[3-(2,2-difluoro-2-phenylethyl)-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 71549894 |
| Molecular Formula | C18H20F4N2O11P2 |
| Molecular Weight | 578.30 g/mol |
| Exact Mass | 578.05 |
| IUPAC Name | [[[(2R,3S,4R,5R)-5-[3-(2,2-difluoro-2-phenylethyl)-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]-difluoromethyl]phosphonic acid |
| SMILES | O=c1ccn([C@@H]2O[C@H](COP(=O)(O)C(F)(F)P(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)n1CC(F)(F)c1ccccc1 |
| InChI | InChI=1S/C18H20F4N2O11P2/c19-17(20,10-4-2-1-3-5-10)9-24-12(25)6-7-23(16(24)28)15-14(27)13(26)11(35-15)8-34-37(32,33)18(21,22)36(29,30)31/h1-7,11,13-15,26-27H,8-9H2,(H,32,33)(H2,29,30,31)/t11-,13-,14-,15-/m1/s1 |
| InChIKey | AIOCVTPJKNTBSB-NMFUWQPSSA-N |
| XLogP | 0.35 |
| TPSA | 197.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.30 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|