C20H24Cl2F2N2O9P2 — CID 174038759
chloro-[1-chloro-1-[[(2R,5R)-5-[3-(2,2-difluoro-2-phenylethyl)-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphanyl]propyl]phosphinic acid (PubChem CID 174038759) has the molecular formula C20H24Cl2F2N2O9P2 and a molecular weight of 607.27 g/mol. Its IUPAC name is chloro-[1-chloro-1-[[(2R,5R)-5-[3-(2,2-difluoro-2-phenylethyl)-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphanyl]propyl]phosphinic acid.
| Compound Name | chloro-[1-chloro-1-[[(2R,5R)-5-[3-(2,2-difluoro-2-phenylethyl)-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphanyl]propyl]phosphinic acid |
|---|---|
| PubChem CID | 174038759 |
| Molecular Formula | C20H24Cl2F2N2O9P2 |
| Molecular Weight | 607.27 g/mol |
| Exact Mass | 606.03 |
| IUPAC Name | chloro-[1-chloro-1-[[(2R,5R)-5-[3-(2,2-difluoro-2-phenylethyl)-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphanyl]propyl]phosphinic acid |
| SMILES | CCC(Cl)(P(O)OC[C@H]1O[C@@H](n2ccc(=O)n(CC(F)(F)c3ccccc3)c2=O)C(O)C1O)P(=O)(O)Cl |
| InChI | InChI=1S/C20H24Cl2F2N2O9P2/c1-2-20(21,37(22,32)33)36(31)34-10-13-15(28)16(29)17(35-13)25-9-8-14(27)26(18(25)30)11-19(23,24)12-6-4-3-5-7-12/h3-9,13,15-17,28-29,31H,2,10-11H2,1H3,(H,32,33)/t13-,15?,16?,17-,20?,36?/m1/s1 |
| InChIKey | ORKQODJFBCHADY-DXCWGKKESA-N |
| XLogP | 2.47 |
| TPSA | 160.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|