C17H19F2IN2O12P2 — CID 163718872
[(2R,3R,4S,5R)-5-[3-(2,2-difluoro-2-phenylethyl)-5-iodo-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 163718872) has the molecular formula C17H19F2IN2O12P2 and a molecular weight of 670.19 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-5-[3-(2,2-difluoro-2-phenylethyl)-5-iodo-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2R,3R,4S,5R)-5-[3-(2,2-difluoro-2-phenylethyl)-5-iodo-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 163718872 |
| Molecular Formula | C17H19F2IN2O12P2 |
| Molecular Weight | 670.19 g/mol |
| Exact Mass | 669.94 |
| IUPAC Name | [(2R,3R,4S,5R)-5-[3-(2,2-difluoro-2-phenylethyl)-5-iodo-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | O=c1c(I)cn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O)[C@H](O)[C@@H]2O)c(=O)n1CC(F)(F)c1ccccc1 |
| InChI | InChI=1S/C17H19F2IN2O12P2/c18-17(19,9-4-2-1-3-5-9)8-22-14(25)10(20)6-21(16(22)26)15-13(24)12(23)11(33-15)7-32-36(30,31)34-35(27,28)29/h1-6,11-13,15,23-24H,7-8H2,(H,30,31)(H2,27,28,29)/t11-,12+,13+,15-/m1/s1 |
| InChIKey | KPSRTYGRQFROFB-UKTARXLSSA-N |
| XLogP | 0.25 |
| TPSA | 206.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.19 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|