C23H35N3O13P2 — CID 171380432
N,N-diethylethanamine;[(2R,3S,4R,5R)-5-(2,4-dioxo-3-phenacylpyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 171380432) has the molecular formula C23H35N3O13P2 and a molecular weight of 623.49 g/mol. Its IUPAC name is N,N-diethylethanamine;[(2R,3S,4R,5R)-5-(2,4-dioxo-3-phenacylpyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | N,N-diethylethanamine;[(2R,3S,4R,5R)-5-(2,4-dioxo-3-phenacylpyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 171380432 |
| Molecular Formula | C23H35N3O13P2 |
| Molecular Weight | 623.49 g/mol |
| Exact Mass | 623.16 |
| IUPAC Name | N,N-diethylethanamine;[(2R,3S,4R,5R)-5-(2,4-dioxo-3-phenacylpyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | CCN(CC)CC.O=C(Cn1c(=O)ccn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)c1=O)c1ccccc1 |
| InChI | InChI=1S/C17H20N2O13P2.C6H15N/c20-11(10-4-2-1-3-5-10)8-19-13(21)6-7-18(17(19)24)16-15(23)14(22)12(31-16)9-30-34(28,29)32-33(25,26)27;1-4-7(5-2)6-3/h1-7,12,14-16,22-23H,8-9H2,(H,28,29)(H2,25,26,27);4-6H2,1-3H3/t12-,14-,15-,16-;/m1./s1 |
| InChIKey | WBCNOMJRSPCOGS-ZLERSDIRSA-N |
| XLogP | 0.09 |
| TPSA | 227.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.49 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|