C20H26F2N4O11P2 — CID 163960632
[[[(2R,5R)-5-[3-[(1,4-dimethyl-4,5-dihydroindazol-3-yl)methyl]-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]-difluoromethyl]phosphonic acid (PubChem CID 163960632) has the molecular formula C20H26F2N4O11P2 and a molecular weight of 598.39 g/mol. Its IUPAC name is [[[(2R,5R)-5-[3-[(1,4-dimethyl-4,5-dihydroindazol-3-yl)methyl]-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]-difluoromethyl]phosphonic acid.
| Compound Name | [[[(2R,5R)-5-[3-[(1,4-dimethyl-4,5-dihydroindazol-3-yl)methyl]-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 163960632 |
| Molecular Formula | C20H26F2N4O11P2 |
| Molecular Weight | 598.39 g/mol |
| Exact Mass | 598.10 |
| IUPAC Name | [[[(2R,5R)-5-[3-[(1,4-dimethyl-4,5-dihydroindazol-3-yl)methyl]-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]-difluoromethyl]phosphonic acid |
| SMILES | CC1CC=Cc2c1c(Cn1c(=O)ccn([C@@H]3O[C@H](COP(=O)(O)C(F)(F)P(=O)(O)O)C(O)C3O)c1=O)nn2C |
| InChI | InChI=1S/C20H26F2N4O11P2/c1-10-4-3-5-12-15(10)11(23-24(12)2)8-26-14(27)6-7-25(19(26)30)18-17(29)16(28)13(37-18)9-36-39(34,35)20(21,22)38(31,32)33/h3,5-7,10,13,16-18,28-29H,4,8-9H2,1-2H3,(H,34,35)(H2,31,32,33)/t10?,13-,16?,17?,18-/m1/s1 |
| InChIKey | SHCPDKGLEJPGAJ-YXGYCLAFSA-N |
| XLogP | -0.14 |
| TPSA | 215.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.39 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|