C28H24N2O4Se — CID 74966242
5-hydroxy-4-(trityloxymethyl)-7-oxa-3-selena-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-10-one (PubChem CID 74966242) has the molecular formula C28H24N2O4Se and a molecular weight of 531.47 g/mol. Its IUPAC name is 5-hydroxy-4-(trityloxymethyl)-7-oxa-3-selena-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-10-one.
| Compound Name | 5-hydroxy-4-(trityloxymethyl)-7-oxa-3-selena-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-10-one |
|---|---|
| PubChem CID | 74966242 |
| Molecular Formula | C28H24N2O4Se |
| Molecular Weight | 531.47 g/mol |
| Exact Mass | 532.09 |
| IUPAC Name | 5-hydroxy-4-(trityloxymethyl)-7-oxa-3-selena-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-10-one |
| SMILES | O=c1ccn2c(n1)OC1C(O)C(COC(c3ccccc3)(c3ccccc3)c3ccccc3)[Se]C12 |
| InChI | InChI=1S/C28H24N2O4Se/c31-23-16-17-30-26-25(34-27(30)29-23)24(32)22(35-26)18-33-28(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-17,22,24-26,32H,18H2 |
| InChIKey | PLVFALYDHRSDBW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|