C30H24N2O6 — CID 11113917
(1S,9R,11R,12R)-11-(trityloxymethyl)-2,10,13-trioxa-4,8-diazatetracyclo[7.6.0.01,12.03,8]pentadeca-3,6-diene-5,14-dione (PubChem CID 11113917) has the molecular formula C30H24N2O6 and a molecular weight of 508.53 g/mol. Its IUPAC name is (1S,9R,11R,12R)-11-(trityloxymethyl)-2,10,13-trioxa-4,8-diazatetracyclo[7.6.0.01,12.03,8]pentadeca-3,6-diene-5,14-dione.
| Compound Name | (1S,9R,11R,12R)-11-(trityloxymethyl)-2,10,13-trioxa-4,8-diazatetracyclo[7.6.0.01,12.03,8]pentadeca-3,6-diene-5,14-dione |
|---|---|
| PubChem CID | 11113917 |
| Molecular Formula | C30H24N2O6 |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | (1S,9R,11R,12R)-11-(trityloxymethyl)-2,10,13-trioxa-4,8-diazatetracyclo[7.6.0.01,12.03,8]pentadeca-3,6-diene-5,14-dione |
| SMILES | O=C1C[C@@]23Oc4nc(=O)ccn4[C@@H]2O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H]3O1 |
| InChI | InChI=1S/C30H24N2O6/c33-24-16-17-32-27-29(38-28(32)31-24)18-25(34)37-26(29)23(36-27)19-35-30(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-17,23,26-27H,18-19H2/t23-,26-,27-,29+/m1/s1 |
| InChIKey | DAULHKCINFSHMG-WXVZLDJUSA-N |
| XLogP | 3.60 |
| TPSA | 88.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|