C24H25IN2O5 — CID 19007161
1-[2-hydroxy-4-phenylmethoxy-3-(phenylmethoxymethyl)cyclopentyl]-5-iodopyrimidine-2,4-dione (PubChem CID 19007161) has the molecular formula C24H25IN2O5 and a molecular weight of 548.38 g/mol. Its IUPAC name is 1-[2-hydroxy-4-phenylmethoxy-3-(phenylmethoxymethyl)cyclopentyl]-5-iodopyrimidine-2,4-dione.
| Compound Name | 1-[2-hydroxy-4-phenylmethoxy-3-(phenylmethoxymethyl)cyclopentyl]-5-iodopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 19007161 |
| Molecular Formula | C24H25IN2O5 |
| Molecular Weight | 548.38 g/mol |
| Exact Mass | 548.08 |
| IUPAC Name | 1-[2-hydroxy-4-phenylmethoxy-3-(phenylmethoxymethyl)cyclopentyl]-5-iodopyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(C2CC(OCc3ccccc3)C(COCc3ccccc3)C2O)cc1I |
| InChI | InChI=1S/C24H25IN2O5/c25-19-12-27(24(30)26-23(19)29)20-11-21(32-14-17-9-5-2-6-10-17)18(22(20)28)15-31-13-16-7-3-1-4-8-16/h1-10,12,18,20-22,28H,11,13-15H2,(H,26,29,30) |
| InChIKey | LVOCGWLPVDLBCG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|