C12H17IN2O5 — CID 18950462
1-[2-hydroxy-4,5-bis(hydroxymethyl)cyclohexyl]-5-iodopyrimidine-2,4-dione (PubChem CID 18950462) has the molecular formula C12H17IN2O5 and a molecular weight of 396.18 g/mol. Its IUPAC name is 1-[2-hydroxy-4,5-bis(hydroxymethyl)cyclohexyl]-5-iodopyrimidine-2,4-dione.
| Compound Name | 1-[2-hydroxy-4,5-bis(hydroxymethyl)cyclohexyl]-5-iodopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 18950462 |
| Molecular Formula | C12H17IN2O5 |
| Molecular Weight | 396.18 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | 1-[2-hydroxy-4,5-bis(hydroxymethyl)cyclohexyl]-5-iodopyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(C2CC(CO)C(CO)CC2O)cc1I |
| InChI | InChI=1S/C12H17IN2O5/c13-8-3-15(12(20)14-11(8)19)9-1-6(4-16)7(5-17)2-10(9)18/h3,6-7,9-10,16-18H,1-2,4-5H2,(H,14,19,20) |
| InChIKey | OGSIUYLLQWUXLR-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 115.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.18 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|