C10H12FIN2O5 — CID 67045394
1-[4-fluoro-5-hydroxy-6-(hydroxymethyl)oxan-3-yl]-5-iodopyrimidine-2,4-dione (PubChem CID 67045394) has the molecular formula C10H12FIN2O5 and a molecular weight of 386.12 g/mol. Its IUPAC name is 1-[4-fluoro-5-hydroxy-6-(hydroxymethyl)oxan-3-yl]-5-iodopyrimidine-2,4-dione.
| Compound Name | 1-[4-fluoro-5-hydroxy-6-(hydroxymethyl)oxan-3-yl]-5-iodopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67045394 |
| Molecular Formula | C10H12FIN2O5 |
| Molecular Weight | 386.12 g/mol |
| Exact Mass | 385.98 |
| IUPAC Name | 1-[4-fluoro-5-hydroxy-6-(hydroxymethyl)oxan-3-yl]-5-iodopyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(C2COC(CO)C(O)C2F)cc1I |
| InChI | InChI=1S/C10H12FIN2O5/c11-7-5(3-19-6(2-15)8(7)16)14-1-4(12)9(17)13-10(14)18/h1,5-8,15-16H,2-3H2,(H,13,17,18) |
| InChIKey | LQYNAWCFDPBUSS-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.12 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|