C9H11IN2O4S — CID 70292582
1-[6-(hydroxymethyl)-1,4-oxathian-3-yl]-5-iodopyrimidine-2,4-dione (PubChem CID 70292582) has the molecular formula C9H11IN2O4S and a molecular weight of 370.17 g/mol. Its IUPAC name is 1-[6-(hydroxymethyl)-1,4-oxathian-3-yl]-5-iodopyrimidine-2,4-dione.
| Compound Name | 1-[6-(hydroxymethyl)-1,4-oxathian-3-yl]-5-iodopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70292582 |
| Molecular Formula | C9H11IN2O4S |
| Molecular Weight | 370.17 g/mol |
| Exact Mass | 369.95 |
| IUPAC Name | 1-[6-(hydroxymethyl)-1,4-oxathian-3-yl]-5-iodopyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(C2COC(CO)CS2)cc1I |
| InChI | InChI=1S/C9H11IN2O4S/c10-6-1-12(9(15)11-8(6)14)7-3-16-5(2-13)4-17-7/h1,5,7,13H,2-4H2,(H,11,14,15) |
| InChIKey | YAKSQCKHFGMPGB-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.17 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|