C10H13IN2O6 — CID 70453049
5-iodo-1-[(1S,4R,5S)-2,3,5-trihydroxy-4-(hydroxymethyl)cyclopentyl]pyrimidine-2,4-dione (PubChem CID 70453049) has the molecular formula C10H13IN2O6 and a molecular weight of 384.13 g/mol. Its IUPAC name is 5-iodo-1-[(1S,4R,5S)-2,3,5-trihydroxy-4-(hydroxymethyl)cyclopentyl]pyrimidine-2,4-dione.
| Compound Name | 5-iodo-1-[(1S,4R,5S)-2,3,5-trihydroxy-4-(hydroxymethyl)cyclopentyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70453049 |
| Molecular Formula | C10H13IN2O6 |
| Molecular Weight | 384.13 g/mol |
| Exact Mass | 383.98 |
| IUPAC Name | 5-iodo-1-[(1S,4R,5S)-2,3,5-trihydroxy-4-(hydroxymethyl)cyclopentyl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@@H]2C(O)C(O)[C@H](CO)[C@@H]2O)cc1I |
| InChI | InChI=1S/C10H13IN2O6/c11-4-1-13(10(19)12-9(4)18)5-6(15)3(2-14)7(16)8(5)17/h1,3,5-8,14-17H,2H2,(H,12,18,19)/t3-,5+,6+,7?,8?/m1/s1 |
| InChIKey | GXNDTVZMNUYDPJ-LAUAQRSYSA-N |
| XLogP | -2.61 |
| TPSA | 135.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.13 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|