C12H15BrN2O6 — CID 88675020
5-(2-bromoethenyl)-1-[(1R,4S,5R)-2,3,5-trihydroxy-4-(hydroxymethyl)cyclopentyl]pyrimidine-2,4-dione (PubChem CID 88675020) has the molecular formula C12H15BrN2O6 and a molecular weight of 363.16 g/mol. Its IUPAC name is 5-(2-bromoethenyl)-1-[(1R,4S,5R)-2,3,5-trihydroxy-4-(hydroxymethyl)cyclopentyl]pyrimidine-2,4-dione.
| Compound Name | 5-(2-bromoethenyl)-1-[(1R,4S,5R)-2,3,5-trihydroxy-4-(hydroxymethyl)cyclopentyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 88675020 |
| Molecular Formula | C12H15BrN2O6 |
| Molecular Weight | 363.16 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | 5-(2-bromoethenyl)-1-[(1R,4S,5R)-2,3,5-trihydroxy-4-(hydroxymethyl)cyclopentyl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@H]2C(O)C(O)[C@@H](CO)[C@H]2O)cc1C=CBr |
| InChI | InChI=1S/C12H15BrN2O6/c13-2-1-5-3-15(12(21)14-11(5)20)7-8(17)6(4-16)9(18)10(7)19/h1-3,6-10,16-19H,4H2,(H,14,20,21)/t6-,7+,8+,9?,10?/m0/s1 |
| InChIKey | MCQITSKLCCEVAM-YMPCNCKUSA-N |
| XLogP | -1.85 |
| TPSA | 135.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.16 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |