C34H37NO3S2Si — CID 174687359
[(4R)-4-[1-(benzenesulfonyl)pyrrol-2-yl]-4-thiophen-2-ylbutoxy]-tert-butyl-diphenylsilane (PubChem CID 174687359) has the molecular formula C34H37NO3S2Si and a molecular weight of 599.89 g/mol. Its IUPAC name is [(4R)-4-[1-(benzenesulfonyl)pyrrol-2-yl]-4-thiophen-2-ylbutoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(4R)-4-[1-(benzenesulfonyl)pyrrol-2-yl]-4-thiophen-2-ylbutoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 174687359 |
| Molecular Formula | C34H37NO3S2Si |
| Molecular Weight | 599.89 g/mol |
| Exact Mass | 599.20 |
| IUPAC Name | [(4R)-4-[1-(benzenesulfonyl)pyrrol-2-yl]-4-thiophen-2-ylbutoxy]-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCCC[C@@H](c1cccs1)c1cccn1S(=O)(=O)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H37NO3S2Si/c1-34(2,3)41(29-18-9-5-10-19-29,30-20-11-6-12-21-30)38-26-14-22-31(33-24-15-27-39-33)32-23-13-25-35(32)40(36,37)28-16-7-4-8-17-28/h4-13,15-21,23-25,27,31H,14,22,26H2,1-3H3/t31-/m1/s1 |
| InChIKey | YGAKJORSCUFXME-WJOKGBTCSA-N |
| XLogP | 7.28 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.89 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|