C24H32INO4 — CID 171078568
benzyl N-[2-[4-hydroxy-3-(3-iodophenyl)-3-methylbutoxy]-2-methylpropyl]-N-methylcarbamate (PubChem CID 171078568) has the molecular formula C24H32INO4 and a molecular weight of 525.43 g/mol. Its IUPAC name is benzyl N-[2-[4-hydroxy-3-(3-iodophenyl)-3-methylbutoxy]-2-methylpropyl]-N-methylcarbamate.
| Compound Name | benzyl N-[2-[4-hydroxy-3-(3-iodophenyl)-3-methylbutoxy]-2-methylpropyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 171078568 |
| Molecular Formula | C24H32INO4 |
| Molecular Weight | 525.43 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | benzyl N-[2-[4-hydroxy-3-(3-iodophenyl)-3-methylbutoxy]-2-methylpropyl]-N-methylcarbamate |
| SMILES | CN(CC(C)(C)OCCC(C)(CO)c1cccc(I)c1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H32INO4/c1-23(2,17-26(4)22(28)29-16-19-9-6-5-7-10-19)30-14-13-24(3,18-27)20-11-8-12-21(25)15-20/h5-12,15,27H,13-14,16-18H2,1-4H3 |
| InChIKey | GBPCQQBCRQNMHK-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.43 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|