C25H31BrINO4 — CID 171078353
benzyl N-[3-[4-bromo-2-(3-iodophenyl)-2-methyl-3-oxobutoxy]-2,2-dimethylpropyl]-N-methylcarbamate (PubChem CID 171078353) has the molecular formula C25H31BrINO4 and a molecular weight of 616.33 g/mol. Its IUPAC name is benzyl N-[3-[4-bromo-2-(3-iodophenyl)-2-methyl-3-oxobutoxy]-2,2-dimethylpropyl]-N-methylcarbamate.
| Compound Name | benzyl N-[3-[4-bromo-2-(3-iodophenyl)-2-methyl-3-oxobutoxy]-2,2-dimethylpropyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 171078353 |
| Molecular Formula | C25H31BrINO4 |
| Molecular Weight | 616.33 g/mol |
| Exact Mass | 615.05 |
| IUPAC Name | benzyl N-[3-[4-bromo-2-(3-iodophenyl)-2-methyl-3-oxobutoxy]-2,2-dimethylpropyl]-N-methylcarbamate |
| SMILES | CN(CC(C)(C)COCC(C)(C(=O)CBr)c1cccc(I)c1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H31BrINO4/c1-24(2,16-28(4)23(30)32-15-19-9-6-5-7-10-19)17-31-18-25(3,22(29)14-26)20-11-8-12-21(27)13-20/h5-13H,14-18H2,1-4H3 |
| InChIKey | DROIVLOXFQWESN-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.33 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|