C24H29IO4 — CID 176852582
tert-butyl 2-(3-iodophenyl)-2-methyl-5-oxo-6-phenylmethoxyhexanoate (PubChem CID 176852582) has the molecular formula C24H29IO4 and a molecular weight of 508.40 g/mol. Its IUPAC name is tert-butyl 2-(3-iodophenyl)-2-methyl-5-oxo-6-phenylmethoxyhexanoate.
| Compound Name | tert-butyl 2-(3-iodophenyl)-2-methyl-5-oxo-6-phenylmethoxyhexanoate |
|---|---|
| PubChem CID | 176852582 |
| Molecular Formula | C24H29IO4 |
| Molecular Weight | 508.40 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | tert-butyl 2-(3-iodophenyl)-2-methyl-5-oxo-6-phenylmethoxyhexanoate |
| SMILES | CC(C)(C)OC(=O)C(C)(CCC(=O)COCc1ccccc1)c1cccc(I)c1 |
| InChI | InChI=1S/C24H29IO4/c1-23(2,3)29-22(27)24(4,19-11-8-12-20(25)15-19)14-13-21(26)17-28-16-18-9-6-5-7-10-18/h5-12,15H,13-14,16-17H2,1-4H3 |
| InChIKey | WOIVYMDZJDZXED-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.40 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|