C18H25IO4 — CID 174251344
2-(3-iodophenyl)-8-methoxy-2,7,7-trimethyl-8-oxooctanoic acid (PubChem CID 174251344) has the molecular formula C18H25IO4 and a molecular weight of 432.30 g/mol. Its IUPAC name is 2-(3-iodophenyl)-8-methoxy-2,7,7-trimethyl-8-oxooctanoic acid.
| Compound Name | 2-(3-iodophenyl)-8-methoxy-2,7,7-trimethyl-8-oxooctanoic acid |
|---|---|
| PubChem CID | 174251344 |
| Molecular Formula | C18H25IO4 |
| Molecular Weight | 432.30 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 2-(3-iodophenyl)-8-methoxy-2,7,7-trimethyl-8-oxooctanoic acid |
| SMILES | COC(=O)C(C)(C)CCCCC(C)(C(=O)O)c1cccc(I)c1 |
| InChI | InChI=1S/C18H25IO4/c1-17(2,16(22)23-4)10-5-6-11-18(3,15(20)21)13-8-7-9-14(19)12-13/h7-9,12H,5-6,10-11H2,1-4H3,(H,20,21) |
| InChIKey | DJWVIWHUTOKNIA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.30 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|