C18H21IO4 — CID 171079641
5-acetyloxy-2-(3-iodophenyl)-2-methylnon-8-ynoic acid (PubChem CID 171079641) has the molecular formula C18H21IO4 and a molecular weight of 428.27 g/mol. Its IUPAC name is 5-acetyloxy-2-(3-iodophenyl)-2-methylnon-8-ynoic acid.
| Compound Name | 5-acetyloxy-2-(3-iodophenyl)-2-methylnon-8-ynoic acid |
|---|---|
| PubChem CID | 171079641 |
| Molecular Formula | C18H21IO4 |
| Molecular Weight | 428.27 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | 5-acetyloxy-2-(3-iodophenyl)-2-methylnon-8-ynoic acid |
| SMILES | C#CCCC(CCC(C)(C(=O)O)c1cccc(I)c1)OC(C)=O |
| InChI | InChI=1S/C18H21IO4/c1-4-5-9-16(23-13(2)20)10-11-18(3,17(21)22)14-7-6-8-15(19)12-14/h1,6-8,12,16H,5,9-11H2,2-3H3,(H,21,22) |
| InChIKey | JNGWEPWOLAGBSS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.27 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|