C19H26BrIO3 — CID 171076997
[8-bromo-6-(3-iodophenyl)-2,2,6-trimethyl-7-oxooctyl] acetate (PubChem CID 171076997) has the molecular formula C19H26BrIO3 and a molecular weight of 509.22 g/mol. Its IUPAC name is [8-bromo-6-(3-iodophenyl)-2,2,6-trimethyl-7-oxooctyl] acetate.
| Compound Name | [8-bromo-6-(3-iodophenyl)-2,2,6-trimethyl-7-oxooctyl] acetate |
|---|---|
| PubChem CID | 171076997 |
| Molecular Formula | C19H26BrIO3 |
| Molecular Weight | 509.22 g/mol |
| Exact Mass | 508.01 |
| IUPAC Name | [8-bromo-6-(3-iodophenyl)-2,2,6-trimethyl-7-oxooctyl] acetate |
| SMILES | CC(=O)OCC(C)(C)CCCC(C)(C(=O)CBr)c1cccc(I)c1 |
| InChI | InChI=1S/C19H26BrIO3/c1-14(22)24-13-18(2,3)9-6-10-19(4,17(23)12-20)15-7-5-8-16(21)11-15/h5,7-8,11H,6,9-10,12-13H2,1-4H3 |
| InChIKey | SRKVPNUOKIUBTG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.22 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|