C18H23IO2 — CID 176852604
2-(3-iodophenyl)-2,5,5-trimethylnon-8-ynoic acid (PubChem CID 176852604) has the molecular formula C18H23IO2 and a molecular weight of 398.28 g/mol. Its IUPAC name is 2-(3-iodophenyl)-2,5,5-trimethylnon-8-ynoic acid.
| Compound Name | 2-(3-iodophenyl)-2,5,5-trimethylnon-8-ynoic acid |
|---|---|
| PubChem CID | 176852604 |
| Molecular Formula | C18H23IO2 |
| Molecular Weight | 398.28 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 2-(3-iodophenyl)-2,5,5-trimethylnon-8-ynoic acid |
| SMILES | C#CCCC(C)(C)CCC(C)(C(=O)O)c1cccc(I)c1 |
| InChI | InChI=1S/C18H23IO2/c1-5-6-10-17(2,3)11-12-18(4,16(20)21)14-8-7-9-15(19)13-14/h1,7-9,13H,6,10-12H2,2-4H3,(H,20,21) |
| InChIKey | OPQAOYBREVABEM-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.28 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|