C14H19IO3 — CID 174252401
6-hydroxy-2-(3-iodophenyl)-2,5-dimethylhexanoic acid (PubChem CID 174252401) has the molecular formula C14H19IO3 and a molecular weight of 362.21 g/mol. Its IUPAC name is 6-hydroxy-2-(3-iodophenyl)-2,5-dimethylhexanoic acid.
| Compound Name | 6-hydroxy-2-(3-iodophenyl)-2,5-dimethylhexanoic acid |
|---|---|
| PubChem CID | 174252401 |
| Molecular Formula | C14H19IO3 |
| Molecular Weight | 362.21 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | 6-hydroxy-2-(3-iodophenyl)-2,5-dimethylhexanoic acid |
| SMILES | CC(CO)CCC(C)(C(=O)O)c1cccc(I)c1 |
| InChI | InChI=1S/C14H19IO3/c1-10(9-16)6-7-14(2,13(17)18)11-4-3-5-12(15)8-11/h3-5,8,10,16H,6-7,9H2,1-2H3,(H,17,18) |
| InChIKey | WNWJFJJDIQRNLL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.21 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|