C23H36INO5 — CID 171079011
methyl 9-hydroxy-2-(3-iodophenyl)-2,5-dimethyl-8-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoate (PubChem CID 171079011) has the molecular formula C23H36INO5 and a molecular weight of 533.45 g/mol. Its IUPAC name is methyl 9-hydroxy-2-(3-iodophenyl)-2,5-dimethyl-8-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoate.
| Compound Name | methyl 9-hydroxy-2-(3-iodophenyl)-2,5-dimethyl-8-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoate |
|---|---|
| PubChem CID | 171079011 |
| Molecular Formula | C23H36INO5 |
| Molecular Weight | 533.45 g/mol |
| Exact Mass | 533.16 |
| IUPAC Name | methyl 9-hydroxy-2-(3-iodophenyl)-2,5-dimethyl-8-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoate |
| SMILES | COC(=O)C(C)(CCC(C)CCC(CO)NC(=O)OC(C)(C)C)c1cccc(I)c1 |
| InChI | InChI=1S/C23H36INO5/c1-16(10-11-19(15-26)25-21(28)30-22(2,3)4)12-13-23(5,20(27)29-6)17-8-7-9-18(24)14-17/h7-9,14,16,19,26H,10-13,15H2,1-6H3,(H,25,28) |
| InChIKey | MSUKNFOYVPGSGZ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.45 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|