C17H28N2O2 — CID 171078472
7-hydroxy-2,6,6-trimethyl-2-(3-methylphenyl)heptanehydrazide (PubChem CID 171078472) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is 7-hydroxy-2,6,6-trimethyl-2-(3-methylphenyl)heptanehydrazide.
| Compound Name | 7-hydroxy-2,6,6-trimethyl-2-(3-methylphenyl)heptanehydrazide |
|---|---|
| PubChem CID | 171078472 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 7-hydroxy-2,6,6-trimethyl-2-(3-methylphenyl)heptanehydrazide |
| SMILES | Cc1cccc(C(C)(CCCC(C)(C)CO)C(=O)NN)c1 |
| InChI | InChI=1S/C17H28N2O2/c1-13-7-5-8-14(11-13)17(4,15(21)19-18)10-6-9-16(2,3)12-20/h5,7-8,11,20H,6,9-10,12,18H2,1-4H3,(H,19,21) |
| InChIKey | RGNCMERGQVIMIN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|