C20H30N2O — CID 171078875
N',2,7,7-tetramethyl-2-(3-methylphenyl)non-8-ynehydrazide (PubChem CID 171078875) has the molecular formula C20H30N2O and a molecular weight of 314.47 g/mol. Its IUPAC name is N',2,7,7-tetramethyl-2-(3-methylphenyl)non-8-ynehydrazide.
| Compound Name | N',2,7,7-tetramethyl-2-(3-methylphenyl)non-8-ynehydrazide |
|---|---|
| PubChem CID | 171078875 |
| Molecular Formula | C20H30N2O |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | N',2,7,7-tetramethyl-2-(3-methylphenyl)non-8-ynehydrazide |
| SMILES | C#CC(C)(C)CCCCC(C)(C(=O)NNC)c1cccc(C)c1 |
| InChI | InChI=1S/C20H30N2O/c1-7-19(3,4)13-8-9-14-20(5,18(23)22-21-6)17-12-10-11-16(2)15-17/h1,10-12,15,21H,8-9,13-14H2,2-6H3,(H,22,23) |
| InChIKey | AGDYFCLZXKZUOY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|