C22H38N2O4S — CID 174263551
(2R)-7-(2-hydroxyethylsulfonyl)-N',2,6,6-tetramethyl-2-(3-propylphenyl)heptanehydrazide (PubChem CID 174263551) has the molecular formula C22H38N2O4S and a molecular weight of 426.62 g/mol. Its IUPAC name is (2R)-7-(2-hydroxyethylsulfonyl)-N',2,6,6-tetramethyl-2-(3-propylphenyl)heptanehydrazide.
| Compound Name | (2R)-7-(2-hydroxyethylsulfonyl)-N',2,6,6-tetramethyl-2-(3-propylphenyl)heptanehydrazide |
|---|---|
| PubChem CID | 174263551 |
| Molecular Formula | C22H38N2O4S |
| Molecular Weight | 426.62 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | (2R)-7-(2-hydroxyethylsulfonyl)-N',2,6,6-tetramethyl-2-(3-propylphenyl)heptanehydrazide |
| SMILES | CCCc1cccc([C@@](C)(CCCC(C)(C)CS(=O)(=O)CCO)C(=O)NNC)c1 |
| InChI | InChI=1S/C22H38N2O4S/c1-6-9-18-10-7-11-19(16-18)22(4,20(26)24-23-5)13-8-12-21(2,3)17-29(27,28)15-14-25/h7,10-11,16,23,25H,6,8-9,12-15,17H2,1-5H3,(H,24,26)/t22-/m1/s1 |
| InChIKey | BPUPXTYXJIOUSN-JOCHJYFZSA-N |
| XLogP | 2.75 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.62 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|