C18H29BrN2O5S — CID 171077098
2-(3-bromophenyl)-3-[3-(2-hydroxyethylsulfonyl)-2,2-dimethylpropoxy]-N',2-dimethylpropanehydrazide (PubChem CID 171077098) has the molecular formula C18H29BrN2O5S and a molecular weight of 465.41 g/mol. Its IUPAC name is 2-(3-bromophenyl)-3-[3-(2-hydroxyethylsulfonyl)-2,2-dimethylpropoxy]-N',2-dimethylpropanehydrazide.
| Compound Name | 2-(3-bromophenyl)-3-[3-(2-hydroxyethylsulfonyl)-2,2-dimethylpropoxy]-N',2-dimethylpropanehydrazide |
|---|---|
| PubChem CID | 171077098 |
| Molecular Formula | C18H29BrN2O5S |
| Molecular Weight | 465.41 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | 2-(3-bromophenyl)-3-[3-(2-hydroxyethylsulfonyl)-2,2-dimethylpropoxy]-N',2-dimethylpropanehydrazide |
| SMILES | CNNC(=O)C(C)(COCC(C)(C)CS(=O)(=O)CCO)c1cccc(Br)c1 |
| InChI | InChI=1S/C18H29BrN2O5S/c1-17(2,13-27(24,25)9-8-22)11-26-12-18(3,16(23)21-20-4)14-6-5-7-15(19)10-14/h5-7,10,20,22H,8-9,11-13H2,1-4H3,(H,21,23) |
| InChIKey | BEZYUTAKVKGBPA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.41 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|