C15H22BrNO3 — CID 110022275
2-(3-bromophenyl)-N-[3-(2-hydroxyethoxy)propyl]-2-methylpropanamide (PubChem CID 110022275) has the molecular formula C15H22BrNO3 and a molecular weight of 344.25 g/mol. Its IUPAC name is 2-(3-bromophenyl)-N-[3-(2-hydroxyethoxy)propyl]-2-methylpropanamide.
| Compound Name | 2-(3-bromophenyl)-N-[3-(2-hydroxyethoxy)propyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 110022275 |
| Molecular Formula | C15H22BrNO3 |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 2-(3-bromophenyl)-N-[3-(2-hydroxyethoxy)propyl]-2-methylpropanamide |
| SMILES | CC(C)(C(=O)NCCCOCCO)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H22BrNO3/c1-15(2,12-5-3-6-13(16)11-12)14(19)17-7-4-9-20-10-8-18/h3,5-6,11,18H,4,7-10H2,1-2H3,(H,17,19) |
| InChIKey | QDXCTHFZJPVHBJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|